C19H28F8O4 — CID 91693711
1-O-heptyl 3-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 2,2-diethylpropanedioate (PubChem CID 91693711) has the molecular formula C19H28F8O4 and a molecular weight of 472.41 g/mol. Its IUPAC name is 1-O-heptyl 3-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 2,2-diethylpropanedioate.
| Compound Name | 1-O-heptyl 3-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91693711 |
| Molecular Formula | C19H28F8O4 |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 1-O-heptyl 3-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 2,2-diethylpropanedioate |
| SMILES | CCCCCCCOC(=O)C(CC)(CC)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C19H28F8O4/c1-4-7-8-9-10-11-30-14(28)16(5-2,6-3)15(29)31-12-17(22,23)19(26,27)18(24,25)13(20)21/h13H,4-12H2,1-3H3 |
| InChIKey | RKWUIKQTYDSOFR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|