C19H29F7O4 — CID 91694846
1-O-(2,2,3,3,4,4,4-heptafluorobutyl) 3-O-octyl 2,2-diethylpropanedioate (PubChem CID 91694846) has the molecular formula C19H29F7O4 and a molecular weight of 454.42 g/mol. Its IUPAC name is 1-O-(2,2,3,3,4,4,4-heptafluorobutyl) 3-O-octyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-(2,2,3,3,4,4,4-heptafluorobutyl) 3-O-octyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91694846 |
| Molecular Formula | C19H29F7O4 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 1-O-(2,2,3,3,4,4,4-heptafluorobutyl) 3-O-octyl 2,2-diethylpropanedioate |
| SMILES | CCCCCCCCOC(=O)C(CC)(CC)C(=O)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H29F7O4/c1-4-7-8-9-10-11-12-29-14(27)16(5-2,6-3)15(28)30-13-17(20,21)18(22,23)19(24,25)26/h4-13H2,1-3H3 |
| InChIKey | YVNZYVKZCKJCQZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|