C7H3F11O — CID 10018385
1,1,2,2,3,3,4,4-octafluoro-5-(1,2,2-trifluoroethenoxy)pentane (PubChem CID 10018385) has the molecular formula C7H3F11O and a molecular weight of 312.08 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-5-(1,2,2-trifluoroethenoxy)pentane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-5-(1,2,2-trifluoroethenoxy)pentane |
|---|---|
| PubChem CID | 10018385 |
| Molecular Formula | C7H3F11O |
| Molecular Weight | 312.08 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-5-(1,2,2-trifluoroethenoxy)pentane |
| SMILES | FC(F)=C(F)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H3F11O/c8-2(9)3(10)19-1-5(13,14)7(17,18)6(15,16)4(11)12/h4H,1H2 |
| InChIKey | IKALFOCYEAOIFS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.08 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|