C7H9F8NO — CID 134263886
2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethanamine (PubChem CID 134263886) has the molecular formula C7H9F8NO and a molecular weight of 275.14 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethanamine.
| Compound Name | 2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethanamine |
|---|---|
| PubChem CID | 134263886 |
| Molecular Formula | C7H9F8NO |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethanamine |
| SMILES | NCCOCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H9F8NO/c8-4(9)6(12,13)7(14,15)5(10,11)3-17-2-1-16/h4H,1-3,16H2 |
| InChIKey | XCVGQANWBKQIKT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|