C5H3F8IO — CID 148632122
2,2,3,3,4,4,5,5-octafluoropentyl hypoiodite (PubChem CID 148632122) has the molecular formula C5H3F8IO and a molecular weight of 357.97 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl hypoiodite.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl hypoiodite |
|---|---|
| PubChem CID | 148632122 |
| Molecular Formula | C5H3F8IO |
| Molecular Weight | 357.97 g/mol |
| Exact Mass | 357.91 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl hypoiodite |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)COI |
| InChI | InChI=1S/C5H3F8IO/c6-2(7)4(10,11)5(12,13)3(8,9)1-15-14/h2H,1H2 |
| InChIKey | NIIVDCLRSYADJA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.97 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|