C30H18F48N3O6P3 — CID 146014385
1,2,3,4,5,6-hexakis(2,2,3,3,4,4,5,5-octafluoropentoxy)-1,3,5,2,4,6-triazatriphosphinane (PubChem CID 146014385) has the molecular formula C30H18F48N3O6P3 and a molecular weight of 1521.32 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexakis(2,2,3,3,4,4,5,5-octafluoropentoxy)-1,3,5,2,4,6-triazatriphosphinane.
| Compound Name | 1,2,3,4,5,6-hexakis(2,2,3,3,4,4,5,5-octafluoropentoxy)-1,3,5,2,4,6-triazatriphosphinane |
|---|---|
| PubChem CID | 146014385 |
| Molecular Formula | C30H18F48N3O6P3 |
| Molecular Weight | 1521.32 g/mol |
| Exact Mass | 1520.96 |
| IUPAC Name | 1,2,3,4,5,6-hexakis(2,2,3,3,4,4,5,5-octafluoropentoxy)-1,3,5,2,4,6-triazatriphosphinane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)CON1P(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)N(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)P(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)N(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)P1OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C30H18F48N3O6P3/c31-7(32)19(55,56)25(67,68)13(43,44)1-82-79-88(85-4-16(49,50)28(73,74)22(61,62)10(37)38)80(83-2-14(45,46)26(69,70)20(57,58)8(33)34)90(87-6-18(53,54)30(77,78)24(65,66)12(41)42)81(84-3-15(47,48)27(71,72)21(59,60)9(35)36)89(79)86-5-17(51,52)29(75,76)23(63,64)11(39)40/h7-12H,1-6H2 |
| InChIKey | RTSGVPIDVJTIGB-UHFFFAOYSA-N |
| XLogP | 17.46 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1521.32 |
| LogP ≤ 5 | 17.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|