C20H12BF32- — CID 22465087
tetrakis(2,2,3,3,4,4,5,5-octafluoropentyl)boranuide (PubChem CID 22465087) has the molecular formula C20H12BF32- and a molecular weight of 871.06 g/mol. Its IUPAC name is tetrakis(2,2,3,3,4,4,5,5-octafluoropentyl)boranuide.
| Compound Name | tetrakis(2,2,3,3,4,4,5,5-octafluoropentyl)boranuide |
|---|---|
| PubChem CID | 22465087 |
| Molecular Formula | C20H12BF32- |
| Molecular Weight | 871.06 g/mol |
| Exact Mass | 871.05 |
| IUPAC Name | tetrakis(2,2,3,3,4,4,5,5-octafluoropentyl)boranuide |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C[B-](CC(F)(F)C(F)(F)C(F)(F)C(F)F)(CC(F)(F)C(F)(F)C(F)(F)C(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C20H12BF32/c22-5(23)13(38,39)17(46,47)9(30,31)1-21(2-10(32,33)18(48,49)14(40,41)6(24)25,3-11(34,35)19(50,51)15(42,43)7(26)27)4-12(36,37)20(52,53)16(44,45)8(28)29/h5-8H,1-4H2/q-1 |
| InChIKey | RFNUKBRHOAZOHN-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.06 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|