C9H8F12 — CID 168937554
1,1,2,2,3,3,4,4,6,6,7,7-dodecafluorononane (PubChem CID 168937554) has the molecular formula C9H8F12 and a molecular weight of 344.14 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,6,6,7,7-dodecafluorononane.
| Compound Name | 1,1,2,2,3,3,4,4,6,6,7,7-dodecafluorononane |
|---|---|
| PubChem CID | 168937554 |
| Molecular Formula | C9H8F12 |
| Molecular Weight | 344.14 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 1,1,2,2,3,3,4,4,6,6,7,7-dodecafluorononane |
| SMILES | CCC(F)(F)C(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H8F12/c1-2-5(12,13)6(14,15)3-7(16,17)9(20,21)8(18,19)4(10)11/h4H,2-3H2,1H3 |
| InChIKey | UKZGANHGMWIOJW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.14 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|