C8H7F11 — CID 59211709
1,1,1,2,2,3,3,5,5,6,6-undecafluorooctane (PubChem CID 59211709) has the molecular formula C8H7F11 and a molecular weight of 312.12 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,5,5,6,6-undecafluorooctane.
| Compound Name | 1,1,1,2,2,3,3,5,5,6,6-undecafluorooctane |
|---|---|
| PubChem CID | 59211709 |
| Molecular Formula | C8H7F11 |
| Molecular Weight | 312.12 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 1,1,1,2,2,3,3,5,5,6,6-undecafluorooctane |
| SMILES | CCC(F)(F)C(F)(F)CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F11/c1-2-4(9,10)5(11,12)3-6(13,14)7(15,16)8(17,18)19/h2-3H2,1H3 |
| InChIKey | BGBBRMNBOXMTBS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.12 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|