C9H12F7I — CID 153324244
1,1,1,2,2,3,3-heptafluoro-5-iodo-5-methyloctane (PubChem CID 153324244) has the molecular formula C9H12F7I and a molecular weight of 380.09 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-5-iodo-5-methyloctane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-5-iodo-5-methyloctane |
|---|---|
| PubChem CID | 153324244 |
| Molecular Formula | C9H12F7I |
| Molecular Weight | 380.09 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-5-iodo-5-methyloctane |
| SMILES | CCCC(C)(I)CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F7I/c1-3-4-6(2,17)5-7(10,11)8(12,13)9(14,15)16/h3-5H2,1-2H3 |
| InChIKey | SINVRZIJDIPKJM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.09 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|