C17H23F13O — CID 162348371
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-methylhexadecan-8-ol (PubChem CID 162348371) has the molecular formula C17H23F13O and a molecular weight of 490.34 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-methylhexadecan-8-ol.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-methylhexadecan-8-ol |
|---|---|
| PubChem CID | 162348371 |
| Molecular Formula | C17H23F13O |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-methylhexadecan-8-ol |
| SMILES | CCCCCCCCC(C)(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H23F13O/c1-3-4-5-6-7-8-9-11(2,31)10-12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h31H,3-10H2,1-2H3 |
| InChIKey | DJTWODLOKYRWKQ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|