C10H17F5O — CID 154220543
1,1,1,2,2-pentafluoro-3-methylnonan-3-ol (PubChem CID 154220543) has the molecular formula C10H17F5O and a molecular weight of 248.23 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-3-methylnonan-3-ol.
| Compound Name | 1,1,1,2,2-pentafluoro-3-methylnonan-3-ol |
|---|---|
| PubChem CID | 154220543 |
| Molecular Formula | C10H17F5O |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-3-methylnonan-3-ol |
| SMILES | CCCCCCC(C)(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H17F5O/c1-3-4-5-6-7-8(2,16)9(11,12)10(13,14)15/h16H,3-7H2,1-2H3 |
| InChIKey | ADWYHSXUIFVVPV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|