C9H13F7O — CID 154267693
1,1,1,2,2,3,3-heptafluoro-4-methyloctan-4-ol (PubChem CID 154267693) has the molecular formula C9H13F7O and a molecular weight of 270.19 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-4-methyloctan-4-ol.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-4-methyloctan-4-ol |
|---|---|
| PubChem CID | 154267693 |
| Molecular Formula | C9H13F7O |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-4-methyloctan-4-ol |
| SMILES | CCCCC(C)(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F7O/c1-3-4-5-6(2,17)7(10,11)8(12,13)9(14,15)16/h17H,3-5H2,1-2H3 |
| InChIKey | UUNYMLYKHVQCCP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|