C9H9F11O — CID 151697911
4,4,5,5,6,6,7,7,8,8,8-undecafluoro-3-methyloctan-3-ol (PubChem CID 151697911) has the molecular formula C9H9F11O and a molecular weight of 342.15 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,8-undecafluoro-3-methyloctan-3-ol.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,8-undecafluoro-3-methyloctan-3-ol |
|---|---|
| PubChem CID | 151697911 |
| Molecular Formula | C9H9F11O |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,8-undecafluoro-3-methyloctan-3-ol |
| SMILES | CCC(C)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F11O/c1-3-4(2,21)5(10,11)6(12,13)7(14,15)8(16,17)9(18,19)20/h21H,3H2,1-2H3 |
| InChIKey | RDYQKMXNHKQETJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|