C14H25F5 — CID 151241914
1,1,1,2,2-pentafluoro-3,3-dimethyldodecane (PubChem CID 151241914) has the molecular formula C14H25F5 and a molecular weight of 288.34 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-3,3-dimethyldodecane.
| Compound Name | 1,1,1,2,2-pentafluoro-3,3-dimethyldodecane |
|---|---|
| PubChem CID | 151241914 |
| Molecular Formula | C14H25F5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-3,3-dimethyldodecane |
| SMILES | CCCCCCCCCC(C)(C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H25F5/c1-4-5-6-7-8-9-10-11-12(2,3)13(15,16)14(17,18)19/h4-11H2,1-3H3 |
| InChIKey | NQMNPBXNGQVOLO-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|