C20H16F26O — CID 10974721
1,1,1,2,2,3,3,4,4,5,5,6,6,14,14,15,15,16,16,17,17,18,18,19,19,19-hexacosafluoro-10-methylnonadecan-10-ol (PubChem CID 10974721) has the molecular formula C20H16F26O and a molecular weight of 766.29 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,14,14,15,15,16,16,17,17,18,18,19,19,19-hexacosafluoro-10-methylnonadecan-10-ol.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,14,14,15,15,16,16,17,17,18,18,19,19,19-hexacosafluoro-10-methylnonadecan-10-ol |
|---|---|
| PubChem CID | 10974721 |
| Molecular Formula | C20H16F26O |
| Molecular Weight | 766.29 g/mol |
| Exact Mass | 766.08 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,14,14,15,15,16,16,17,17,18,18,19,19,19-hexacosafluoro-10-methylnonadecan-10-ol |
| SMILES | CC(O)(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H16F26O/c1-8(47,4-2-6-9(21,22)11(25,26)13(29,30)15(33,34)17(37,38)19(41,42)43)5-3-7-10(23,24)12(27,28)14(31,32)16(35,36)18(39,40)20(44,45)46/h47H,2-7H2,1H3 |
| InChIKey | DVQHGEDQHXZXAI-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.29 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|