C14H9F17O — CID 57059451
6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluoro-2-methyltridec-1-en-1-one (PubChem CID 57059451) has the molecular formula C14H9F17O and a molecular weight of 516.19 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluoro-2-methyltridec-1-en-1-one.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluoro-2-methyltridec-1-en-1-one |
|---|---|
| PubChem CID | 57059451 |
| Molecular Formula | C14H9F17O |
| Molecular Weight | 516.19 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluoro-2-methyltridec-1-en-1-one |
| SMILES | CC(=C=O)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H9F17O/c1-6(5-32)3-2-4-7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h2-4H2,1H3 |
| InChIKey | SLVHYIWIQUIWOM-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.19 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|