C13H18F9I — CID 153324032
6-ethyl-1,1,1,2,2,3,3,4,4-nonafluoro-6-iodoundecane (PubChem CID 153324032) has the molecular formula C13H18F9I and a molecular weight of 472.17 g/mol. Its IUPAC name is 6-ethyl-1,1,1,2,2,3,3,4,4-nonafluoro-6-iodoundecane.
| Compound Name | 6-ethyl-1,1,1,2,2,3,3,4,4-nonafluoro-6-iodoundecane |
|---|---|
| PubChem CID | 153324032 |
| Molecular Formula | C13H18F9I |
| Molecular Weight | 472.17 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 6-ethyl-1,1,1,2,2,3,3,4,4-nonafluoro-6-iodoundecane |
| SMILES | CCCCCC(I)(CC)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H18F9I/c1-3-5-6-7-9(23,4-2)8-10(14,15)11(16,17)12(18,19)13(20,21)22/h3-8H2,1-2H3 |
| InChIKey | FIAJIEXAQKMVOX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.17 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|