C15H22F9I — CID 153324207
5-ethyl-1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)dodecane (PubChem CID 153324207) has the molecular formula C15H22F9I and a molecular weight of 500.23 g/mol. Its IUPAC name is 5-ethyl-1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)dodecane.
| Compound Name | 5-ethyl-1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)dodecane |
|---|---|
| PubChem CID | 153324207 |
| Molecular Formula | C15H22F9I |
| Molecular Weight | 500.23 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 5-ethyl-1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)dodecane |
| SMILES | CCCCCCCC(I)(CC)CC(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H22F9I/c1-3-5-6-7-8-9-11(25,4-2)10-12(16,14(19,20)21)13(17,18)15(22,23)24/h3-10H2,1-2H3 |
| InChIKey | QVEFUVXUZRIPOG-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.23 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|