C12H14F11I — CID 153324304
7-ethyl-1,1,1,2,2,3,3,4,4,5,5-undecafluoro-7-iododecane (PubChem CID 153324304) has the molecular formula C12H14F11I and a molecular weight of 494.13 g/mol. Its IUPAC name is 7-ethyl-1,1,1,2,2,3,3,4,4,5,5-undecafluoro-7-iododecane.
| Compound Name | 7-ethyl-1,1,1,2,2,3,3,4,4,5,5-undecafluoro-7-iododecane |
|---|---|
| PubChem CID | 153324304 |
| Molecular Formula | C12H14F11I |
| Molecular Weight | 494.13 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | 7-ethyl-1,1,1,2,2,3,3,4,4,5,5-undecafluoro-7-iododecane |
| SMILES | CCCC(I)(CC)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H14F11I/c1-3-5-7(24,4-2)6-8(13,14)9(15,16)10(17,18)11(19,20)12(21,22)23/h3-6H2,1-2H3 |
| InChIKey | XOOGIDUXNVMHKG-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.13 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|