C8H8F9I — CID 153324351
1,1,1,2,2,3,3,4,4-nonafluoro-6-iodo-6-methylheptane (PubChem CID 153324351) has the molecular formula C8H8F9I and a molecular weight of 402.04 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodo-6-methylheptane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodo-6-methylheptane |
|---|---|
| PubChem CID | 153324351 |
| Molecular Formula | C8H8F9I |
| Molecular Weight | 402.04 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodo-6-methylheptane |
| SMILES | CC(C)(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F9I/c1-4(2,18)3-5(9,10)6(11,12)7(13,14)8(15,16)17/h3H2,1-2H3 |
| InChIKey | XUVRXXXOPQOKQY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.04 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|