C6H3F11S — CID 87800891
1,1,3,3,4,4,5,5,6,6,6-undecafluorohexane-1-thiol (PubChem CID 87800891) has the molecular formula C6H3F11S and a molecular weight of 316.14 g/mol. Its IUPAC name is 1,1,3,3,4,4,5,5,6,6,6-undecafluorohexane-1-thiol.
| Compound Name | 1,1,3,3,4,4,5,5,6,6,6-undecafluorohexane-1-thiol |
|---|---|
| PubChem CID | 87800891 |
| Molecular Formula | C6H3F11S |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 1,1,3,3,4,4,5,5,6,6,6-undecafluorohexane-1-thiol |
| SMILES | FC(F)(S)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H3F11S/c7-2(8,1-3(9,10)18)4(11,12)5(13,14)6(15,16)17/h18H,1H2 |
| InChIKey | RUKSPJTYLVDDGF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|