C12H11F17O2Si — CID 173144574
(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1,1-dimethoxydecyl)silane (PubChem CID 173144574) has the molecular formula C12H11F17O2Si and a molecular weight of 538.27 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1,1-dimethoxydecyl)silane.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1,1-dimethoxydecyl)silane |
|---|---|
| PubChem CID | 173144574 |
| Molecular Formula | C12H11F17O2Si |
| Molecular Weight | 538.27 g/mol |
| Exact Mass | 538.03 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1,1-dimethoxydecyl)silane |
| SMILES | COC([SiH3])(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC |
| InChI | InChI=1S/C12H11F17O2Si/c1-30-5(32,31-2)3-4(13,14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)29/h3H2,1-2,32H3 |
| InChIKey | JOFFQKRAOODPQM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.27 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|