C11H9F13O3 — CID 155658145
methyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-2-methylnonanoate (PubChem CID 155658145) has the molecular formula C11H9F13O3 and a molecular weight of 436.16 g/mol. Its IUPAC name is methyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-2-methylnonanoate.
| Compound Name | methyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-2-methylnonanoate |
|---|---|
| PubChem CID | 155658145 |
| Molecular Formula | C11H9F13O3 |
| Molecular Weight | 436.16 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | methyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-2-methylnonanoate |
| SMILES | COC(=O)C(C)(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F13O3/c1-5(26,4(25)27-2)3-6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h26H,3H2,1-2H3 |
| InChIKey | CDFFTPJXBYZPFL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.16 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|