C10H15F5O3 — CID 162347615
tert-butyl 4,4,5,5,5-pentafluoro-2-hydroxy-2-methylpentanoate (PubChem CID 162347615) has the molecular formula C10H15F5O3 and a molecular weight of 278.22 g/mol. Its IUPAC name is tert-butyl 4,4,5,5,5-pentafluoro-2-hydroxy-2-methylpentanoate.
| Compound Name | tert-butyl 4,4,5,5,5-pentafluoro-2-hydroxy-2-methylpentanoate |
|---|---|
| PubChem CID | 162347615 |
| Molecular Formula | C10H15F5O3 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | tert-butyl 4,4,5,5,5-pentafluoro-2-hydroxy-2-methylpentanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(O)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H15F5O3/c1-7(2,3)18-6(16)8(4,17)5-9(11,12)10(13,14)15/h17H,5H2,1-4H3 |
| InChIKey | PXCBNFFGRVITTK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|