C8H9F7O2 — CID 15613838
tert-butyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 15613838) has the molecular formula C8H9F7O2 and a molecular weight of 270.14 g/mol. Its IUPAC name is tert-butyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | tert-butyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 15613838 |
| Molecular Formula | C8H9F7O2 |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | tert-butyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC(C)(C)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F7O2/c1-5(2,3)17-4(16)6(9,10)7(11,12)8(13,14)15/h1-3H3 |
| InChIKey | JPVACFHILHDRGX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|