C4F9O2P — CID 23234687
difluorophosphanyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 23234687) has the molecular formula C4F9O2P and a molecular weight of 282.00 g/mol. Its IUPAC name is difluorophosphanyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | difluorophosphanyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 23234687 |
| Molecular Formula | C4F9O2P |
| Molecular Weight | 282.00 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | difluorophosphanyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(OP(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4F9O2P/c5-2(6,1(14)15-16(12)13)3(7,8)4(9,10)11 |
| InChIKey | AXGCWEMKEQOFIU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.00 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|