C6F10O3 — CID 156768944
(2,2,2-trifluoroacetyl) 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 156768944) has the molecular formula C6F10O3 and a molecular weight of 310.04 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 156768944 |
| Molecular Formula | C6F10O3 |
| Molecular Weight | 310.04 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6F10O3/c7-3(8,5(12,13)6(14,15)16)1(17)19-2(18)4(9,10)11 |
| InChIKey | BIRGWFAXPSEWNZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.04 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|