C4H4F6N2O6 — CID 86750628
azanium;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate;nitrate (PubChem CID 86750628) has the molecular formula C4H4F6N2O6 and a molecular weight of 290.07 g/mol. Its IUPAC name is azanium;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate;nitrate.
| Compound Name | azanium;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate;nitrate |
|---|---|
| PubChem CID | 86750628 |
| Molecular Formula | C4H4F6N2O6 |
| Molecular Weight | 290.07 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | azanium;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate;nitrate |
| SMILES | O=C(OC(=O)C(F)(F)F)C(F)(F)F.O=[N+]([O-])[O-].[NH4+] |
| InChI | InChI=1S/C4F6O3.NO3.H3N/c5-3(6,7)1(11)13-2(12)4(8,9)10;2-1(3)4;/h;;1H3/q;-1;/p+1 |
| InChIKey | QDBKNJWZARJBIO-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 146.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.07 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|