C4H3Cu2F3O3 — CID 174842973
acetyl 2,2,2-trifluoroacetate;copper (PubChem CID 174842973) has the molecular formula C4H3Cu2F3O3 and a molecular weight of 283.15 g/mol. Its IUPAC name is acetyl 2,2,2-trifluoroacetate;copper.
| Compound Name | acetyl 2,2,2-trifluoroacetate;copper |
|---|---|
| PubChem CID | 174842973 |
| Molecular Formula | C4H3Cu2F3O3 |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 281.86 |
| IUPAC Name | acetyl 2,2,2-trifluoroacetate;copper |
| SMILES | CC(=O)OC(=O)C(F)(F)F.[Cu].[Cu] |
| InChI | InChI=1S/C4H3F3O3.2Cu/c1-2(8)10-3(9)4(5,6)7;;/h1H3;; |
| InChIKey | NBGUPPQZHKMZIU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|