C22H18F3O3P — CID 174839065
acetyl 2,2,2-trifluoroacetate;triphenylphosphane (PubChem CID 174839065) has the molecular formula C22H18F3O3P and a molecular weight of 418.35 g/mol. Its IUPAC name is acetyl 2,2,2-trifluoroacetate;triphenylphosphane.
| Compound Name | acetyl 2,2,2-trifluoroacetate;triphenylphosphane |
|---|---|
| PubChem CID | 174839065 |
| Molecular Formula | C22H18F3O3P |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | acetyl 2,2,2-trifluoroacetate;triphenylphosphane |
| SMILES | CC(=O)OC(=O)C(F)(F)F.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C4H3F3O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2(8)10-3(9)4(5,6)7/h1-15H;1H3 |
| InChIKey | FZRBVUAGLVTHKU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|