C10H12F6O3 — CID 175538194
cyclohexane;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 175538194) has the molecular formula C10H12F6O3 and a molecular weight of 294.19 g/mol. Its IUPAC name is cyclohexane;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | cyclohexane;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 175538194 |
| Molecular Formula | C10H12F6O3 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | cyclohexane;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | C1CCCCC1.O=C(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H12.C4F6O3/c1-2-4-6-5-3-1;5-3(6,7)1(11)13-2(12)4(8,9)10/h1-6H2; |
| InChIKey | HCONYMNMKLVYGD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|