C5H4F3NO3 — CID 143424317
(3-amino-3-oxoprop-1-en-2-yl) 2,2,2-trifluoroacetate (PubChem CID 143424317) has the molecular formula C5H4F3NO3 and a molecular weight of 183.08 g/mol. Its IUPAC name is (3-amino-3-oxoprop-1-en-2-yl) 2,2,2-trifluoroacetate.
| Compound Name | (3-amino-3-oxoprop-1-en-2-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 143424317 |
| Molecular Formula | C5H4F3NO3 |
| Molecular Weight | 183.08 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | (3-amino-3-oxoprop-1-en-2-yl) 2,2,2-trifluoroacetate |
| SMILES | C=C(OC(=O)C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C5H4F3NO3/c1-2(3(9)10)12-4(11)5(6,7)8/h1H2,(H2,9,10) |
| InChIKey | AHNZQVIMPJAOTP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.08 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|