C5ClF7O2 — CID 15655236
(3-chloro-1,1,3,3-tetrafluoroprop-1-en-2-yl) 2,2,2-trifluoroacetate (PubChem CID 15655236) has the molecular formula C5ClF7O2 and a molecular weight of 260.49 g/mol. Its IUPAC name is (3-chloro-1,1,3,3-tetrafluoroprop-1-en-2-yl) 2,2,2-trifluoroacetate.
| Compound Name | (3-chloro-1,1,3,3-tetrafluoroprop-1-en-2-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 15655236 |
| Molecular Formula | C5ClF7O2 |
| Molecular Weight | 260.49 g/mol |
| Exact Mass | 259.95 |
| IUPAC Name | (3-chloro-1,1,3,3-tetrafluoroprop-1-en-2-yl) 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(=C(F)F)C(F)(F)Cl)C(F)(F)F |
| InChI | InChI=1S/C5ClF7O2/c6-4(9,10)1(2(7)8)15-3(14)5(11,12)13 |
| InChIKey | XHHUNBUQSROSDJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|