C11H6F10O4 — CID 101472859
bis(1,1,3,3,3-pentafluoroprop-1-en-2-yl) pentanedioate (PubChem CID 101472859) has the molecular formula C11H6F10O4 and a molecular weight of 392.15 g/mol. Its IUPAC name is bis(1,1,3,3,3-pentafluoroprop-1-en-2-yl) pentanedioate.
| Compound Name | bis(1,1,3,3,3-pentafluoroprop-1-en-2-yl) pentanedioate |
|---|---|
| PubChem CID | 101472859 |
| Molecular Formula | C11H6F10O4 |
| Molecular Weight | 392.15 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | bis(1,1,3,3,3-pentafluoroprop-1-en-2-yl) pentanedioate |
| SMILES | O=C(CCCC(=O)OC(=C(F)F)C(F)(F)F)OC(=C(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H6F10O4/c12-8(13)6(10(16,17)18)24-4(22)2-1-3-5(23)25-7(9(14)15)11(19,20)21/h1-3H2 |
| InChIKey | UKFQCNMEJKBLHN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.15 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|