About butanoyl 5-oxohexanoate;zirconium
butanoyl 5-oxohexanoate;zirconium (PubChem CID 89414509) has the molecular formula C10H16O4Zr
and a molecular weight of 291.46 g/mol. Its IUPAC name is butanoyl 5-oxohexanoate;zirconium.
Molecular Properties
| Compound Name | butanoyl 5-oxohexanoate;zirconium |
| PubChem CID | 89414509 |
| Molecular Formula | C10H16O4Zr |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | butanoyl 5-oxohexanoate;zirconium |
| SMILES | CCCC(=O)OC(=O)CCCC(C)=O.[Zr] |
| InChI | InChI=1S/C10H16O4.Zr/c1-3-5-9(12)14-10(13)7-4-6-8(2)11;/h3-7H2,1-2H3; |
| InChIKey | MJTFUANTEYZXDC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butanoyl 5-oxohexanoate;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoyl 5-oxohexanoate;zirconium?
The IUPAC name of butanoyl 5-oxohexanoate;zirconium (CID 89414509) is butanoyl 5-oxohexanoate;zirconium.
What is the SMILES notation for butanoyl 5-oxohexanoate;zirconium?
The canonical SMILES for butanoyl 5-oxohexanoate;zirconium is CCCC(=O)OC(=O)CCCC(C)=O.[Zr].
What is the InChIKey of butanoyl 5-oxohexanoate;zirconium?
The InChIKey is MJTFUANTEYZXDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4.Zr/c1-3-5-9(12)14-10(13)7-4-6-8(2)11;/h3-7H2,1-2H3;.
What are the key properties of butanoyl 5-oxohexanoate;zirconium?
butanoyl 5-oxohexanoate;zirconium has a molecular weight of 291.46 g/mol, XLogP of 1.61, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanoyl 5-oxohexanoate;zirconium is sourced from PubChem (CID 89414509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).