About sodium;butanoyl butanoate;hydride
sodium;butanoyl butanoate;hydride (PubChem CID 173362700) has the molecular formula C8H15NaO3
and a molecular weight of 182.19 g/mol. Its IUPAC name is sodium;butanoyl butanoate;hydride.
Molecular Properties
| Compound Name | sodium;butanoyl butanoate;hydride |
| PubChem CID | 173362700 |
| Molecular Formula | C8H15NaO3 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | sodium;butanoyl butanoate;hydride |
| SMILES | CCCC(=O)OC(=O)CCC.[H-].[Na+] |
| InChI | InChI=1S/C8H14O3.Na.H/c1-3-5-7(9)11-8(10)6-4-2;;/h3-6H2,1-2H3;;/q;+1;-1 |
| InChIKey | IYAXYHSGLHVMJB-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze sodium;butanoyl butanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;butanoyl butanoate;hydride?
The IUPAC name of sodium;butanoyl butanoate;hydride (CID 173362700) is sodium;butanoyl butanoate;hydride.
What is the SMILES notation for sodium;butanoyl butanoate;hydride?
The canonical SMILES for sodium;butanoyl butanoate;hydride is CCCC(=O)OC(=O)CCC.[H-].[Na+].
What is the InChIKey of sodium;butanoyl butanoate;hydride?
The InChIKey is IYAXYHSGLHVMJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3.Na.H/c1-3-5-7(9)11-8(10)6-4-2;;/h3-6H2,1-2H3;;/q;+1;-1.
What are the key properties of sodium;butanoyl butanoate;hydride?
sodium;butanoyl butanoate;hydride has a molecular weight of 182.19 g/mol, XLogP of -1.23, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;butanoyl butanoate;hydride is sourced from PubChem (CID 173362700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).