About butanoyl butanoate;1-chloropentane
butanoyl butanoate;1-chloropentane (PubChem CID 174886671) has the molecular formula C13H25ClO3
and a molecular weight of 264.79 g/mol. Its IUPAC name is butanoyl butanoate;1-chloropentane.
Molecular Properties
| Compound Name | butanoyl butanoate;1-chloropentane |
| PubChem CID | 174886671 |
| Molecular Formula | C13H25ClO3 |
| Molecular Weight | 264.79 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | butanoyl butanoate;1-chloropentane |
| SMILES | CCCC(=O)OC(=O)CCC.CCCCCCl |
| InChI | InChI=1S/C8H14O3.C5H11Cl/c1-3-5-7(9)11-8(10)6-4-2;1-2-3-4-5-6/h3-6H2,1-2H3;2-5H2,1H3 |
| InChIKey | GYHVUMKHOWYETK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.79 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butanoyl butanoate;1-chloropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoyl butanoate;1-chloropentane?
The IUPAC name of butanoyl butanoate;1-chloropentane (CID 174886671) is butanoyl butanoate;1-chloropentane.
What is the SMILES notation for butanoyl butanoate;1-chloropentane?
The canonical SMILES for butanoyl butanoate;1-chloropentane is CCCC(=O)OC(=O)CCC.CCCCCCl.
What is the InChIKey of butanoyl butanoate;1-chloropentane?
The InChIKey is GYHVUMKHOWYETK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3.C5H11Cl/c1-3-5-7(9)11-8(10)6-4-2;1-2-3-4-5-6/h3-6H2,1-2H3;2-5H2,1H3.
What are the key properties of butanoyl butanoate;1-chloropentane?
butanoyl butanoate;1-chloropentane has a molecular weight of 264.79 g/mol, XLogP of 4.07, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanoyl butanoate;1-chloropentane is sourced from PubChem (CID 174886671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).