C12H17F5O2 — CID 91327981
ethane;1,1,3,3,3-pentafluoroprop-1-en-2-yl cyclohexanecarboxylate (PubChem CID 91327981) has the molecular formula C12H17F5O2 and a molecular weight of 288.26 g/mol. Its IUPAC name is ethane;1,1,3,3,3-pentafluoroprop-1-en-2-yl cyclohexanecarboxylate.
| Compound Name | ethane;1,1,3,3,3-pentafluoroprop-1-en-2-yl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 91327981 |
| Molecular Formula | C12H17F5O2 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | ethane;1,1,3,3,3-pentafluoroprop-1-en-2-yl cyclohexanecarboxylate |
| SMILES | CC.O=C(OC(=C(F)F)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H11F5O2.C2H6/c11-8(12)7(10(13,14)15)17-9(16)6-4-2-1-3-5-6;1-2/h6H,1-5H2;1-2H3 |
| InChIKey | HZKZNWUOYQBTBS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|