C11H13F6O5S- — CID 59445735
2-(cyclohexanecarbonyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate (PubChem CID 59445735) has the molecular formula C11H13F6O5S- and a molecular weight of 371.28 g/mol. Its IUPAC name is 2-(cyclohexanecarbonyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate.
| Compound Name | 2-(cyclohexanecarbonyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 59445735 |
| Molecular Formula | C11H13F6O5S- |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 2-(cyclohexanecarbonyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate |
| SMILES | O=C(OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C11H14F6O5S/c12-10(13,14)9(11(15,16)17,6-23(19,20)21)22-8(18)7-4-2-1-3-5-7/h7H,1-6H2,(H,19,20,21)/p-1 |
| InChIKey | QSPWRUKHDHHFER-UHFFFAOYSA-M |
| XLogP | 2.52 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|