C7H7F6O5S- — CID 140850758
3,3,3-trifluoro-2-propanoyloxy-2-(trifluoromethyl)propane-1-sulfonate (PubChem CID 140850758) has the molecular formula C7H7F6O5S- and a molecular weight of 317.18 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-propanoyloxy-2-(trifluoromethyl)propane-1-sulfonate.
| Compound Name | 3,3,3-trifluoro-2-propanoyloxy-2-(trifluoromethyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 140850758 |
| Molecular Formula | C7H7F6O5S- |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 3,3,3-trifluoro-2-propanoyloxy-2-(trifluoromethyl)propane-1-sulfonate |
| SMILES | CCC(=O)OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F6O5S/c1-2-4(14)18-5(6(8,9)10,7(11,12)13)3-19(15,16)17/h2-3H2,1H3,(H,15,16,17)/p-1 |
| InChIKey | PYBMSEQCCGZGLV-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|