C14H15F6O7S- — CID 140770677
3,3,3-trifluoro-2-(4-prop-2-enoyloxycyclohexanecarbonyl)oxy-2-(trifluoromethyl)propane-1-sulfonate (PubChem CID 140770677) has the molecular formula C14H15F6O7S- and a molecular weight of 441.32 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(4-prop-2-enoyloxycyclohexanecarbonyl)oxy-2-(trifluoromethyl)propane-1-sulfonate.
| Compound Name | 3,3,3-trifluoro-2-(4-prop-2-enoyloxycyclohexanecarbonyl)oxy-2-(trifluoromethyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 140770677 |
| Molecular Formula | C14H15F6O7S- |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 3,3,3-trifluoro-2-(4-prop-2-enoyloxycyclohexanecarbonyl)oxy-2-(trifluoromethyl)propane-1-sulfonate |
| SMILES | C=CC(=O)OC1CCC(C(=O)OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H16F6O7S/c1-2-10(21)26-9-5-3-8(4-6-9)11(22)27-12(13(15,16)17,14(18,19)20)7-28(23,24)25/h2,8-9H,1,3-7H2,(H,23,24,25)/p-1 |
| InChIKey | BHRCCVCRYXUCDK-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|