C10H14F3NO4S — CID 58980520
[4-(trifluoromethylsulfonylamino)cyclohexyl] prop-2-enoate (PubChem CID 58980520) has the molecular formula C10H14F3NO4S and a molecular weight of 301.29 g/mol. Its IUPAC name is [4-(trifluoromethylsulfonylamino)cyclohexyl] prop-2-enoate.
| Compound Name | [4-(trifluoromethylsulfonylamino)cyclohexyl] prop-2-enoate |
|---|---|
| PubChem CID | 58980520 |
| Molecular Formula | C10H14F3NO4S |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | [4-(trifluoromethylsulfonylamino)cyclohexyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC(NS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H14F3NO4S/c1-2-9(15)18-8-5-3-7(4-6-8)14-19(16,17)10(11,12)13/h2,7-8,14H,1,3-6H2 |
| InChIKey | CQVSYKGGZJBGJI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|