C12H18O2 — CID 20727671
2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl prop-2-enoate (PubChem CID 20727671) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl prop-2-enoate.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl prop-2-enoate |
|---|---|
| PubChem CID | 20727671 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC2CCCC2C1 |
| InChI | InChI=1S/C12H18O2/c1-2-12(13)14-11-7-6-9-4-3-5-10(9)8-11/h2,9-11H,1,3-8H2 |
| InChIKey | VNYSTZXOEPSEHX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|