C29H40O9 — CID 140713471
[4-(4-methoxycyclohexyl)cyclohexyl] 3,4,5-tri(prop-2-enoyloxy)cyclohexane-1-carboxylate (PubChem CID 140713471) has the molecular formula C29H40O9 and a molecular weight of 532.63 g/mol. Its IUPAC name is [4-(4-methoxycyclohexyl)cyclohexyl] 3,4,5-tri(prop-2-enoyloxy)cyclohexane-1-carboxylate.
| Compound Name | [4-(4-methoxycyclohexyl)cyclohexyl] 3,4,5-tri(prop-2-enoyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 140713471 |
| Molecular Formula | C29H40O9 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | [4-(4-methoxycyclohexyl)cyclohexyl] 3,4,5-tri(prop-2-enoyloxy)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OC1CC(C(=O)OC2CCC(C3CCC(OC)CC3)CC2)CC(OC(=O)C=C)C1OC(=O)C=C |
| InChI | InChI=1S/C29H40O9/c1-5-25(30)36-23-16-20(17-24(37-26(31)6-2)28(23)38-27(32)7-3)29(33)35-22-14-10-19(11-15-22)18-8-12-21(34-4)13-9-18/h5-7,18-24,28H,1-3,8-17H2,4H3 |
| InChIKey | GAVIRQWKCQPXIN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|