C16H22O3 — CID 20727718
(9-methoxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) prop-2-enoate (PubChem CID 20727718) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (9-methoxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) prop-2-enoate.
| Compound Name | (9-methoxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) prop-2-enoate |
|---|---|
| PubChem CID | 20727718 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (9-methoxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) prop-2-enoate |
| SMILES | C=CC(=O)OC1CC2CC1C1C3CC(OC)C(C3)C21 |
| InChI | InChI=1S/C16H22O3/c1-3-14(17)19-13-7-9-5-11(13)16-8-4-10(15(9)16)12(6-8)18-2/h3,8-13,15-16H,1,4-7H2,2H3 |
| InChIKey | XSJDWZLHAPBAGW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|