C13H16O3 — CID 59642033
9-oxatetracyclo[5.3.1.02,6.08,10]undecan-3-yl prop-2-enoate (PubChem CID 59642033) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 9-oxatetracyclo[5.3.1.02,6.08,10]undecan-3-yl prop-2-enoate.
| Compound Name | 9-oxatetracyclo[5.3.1.02,6.08,10]undecan-3-yl prop-2-enoate |
|---|---|
| PubChem CID | 59642033 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 9-oxatetracyclo[5.3.1.02,6.08,10]undecan-3-yl prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC2C3CC(C4OC34)C12 |
| InChI | InChI=1S/C13H16O3/c1-2-10(14)15-9-4-3-6-7-5-8(11(6)9)13-12(7)16-13/h2,6-9,11-13H,1,3-5H2 |
| InChIKey | HHWZGFUGKRNXAL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|