C13H18O5 — CID 58785738
[9-(2-hydroxypropan-2-yl)-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl] prop-2-enoate (PubChem CID 58785738) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is [9-(2-hydroxypropan-2-yl)-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl] prop-2-enoate.
| Compound Name | [9-(2-hydroxypropan-2-yl)-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 58785738 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [9-(2-hydroxypropan-2-yl)-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1C2OCC3C2OC1C3C(C)(C)O |
| InChI | InChI=1S/C13H18O5/c1-4-7(14)17-12-10-8(13(2,3)15)6-5-16-11(12)9(6)18-10/h4,6,8-12,15H,1,5H2,2-3H3 |
| InChIKey | LHJCDAJGASLGIA-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|