C12H16O5 — CID 58785764
(2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methyl acetate (PubChem CID 58785764) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methyl acetate.
| Compound Name | (2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methyl acetate |
|---|---|
| PubChem CID | 58785764 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2-ethenoxy-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methyl acetate |
| SMILES | C=COC1C2OC3C(COC31)C2COC(C)=O |
| InChI | InChI=1S/C12H16O5/c1-3-14-11-9-7(4-15-6(2)13)8-5-16-12(11)10(8)17-9/h3,7-12H,1,4-5H2,2H3 |
| InChIKey | BIJIWIGDZHQGHY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|