C8H12O6 — CID 118903241
[(2S)-4-acetyloxy-1,3-dioxolan-2-yl]methyl acetate (PubChem CID 118903241) has the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. Its IUPAC name is [(2S)-4-acetyloxy-1,3-dioxolan-2-yl]methyl acetate.
| Compound Name | [(2S)-4-acetyloxy-1,3-dioxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118903241 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | [(2S)-4-acetyloxy-1,3-dioxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OCC(OC(C)=O)O1 |
| InChI | InChI=1S/C8H12O6/c1-5(9)11-3-7-12-4-8(14-7)13-6(2)10/h7-8H,3-4H2,1-2H3/t7-,8?/m0/s1 |
| InChIKey | IEACXDOKNCCUGM-JAMMHHFISA-N |
| XLogP | -0.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |